
CAS 1803600-15-8
:Azetidine, 3-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:1)
Description:
Azetidine, 3-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,4-difluorophenyl group indicates that the compound has two fluorine substituents on a phenyl ring, which can influence its electronic properties and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various biological activities, potentially making it of interest in medicinal chemistry. Its molecular structure suggests that it could interact with biological targets, possibly influencing neurotransmitter systems or other pathways. The specific characteristics, such as melting point, solubility, and reactivity, would depend on the compound's detailed molecular interactions and the environment in which it is used. Overall, this compound represents a class of substances that may have significant implications in drug development and therapeutic applications.
Formula:C10H11F2N·ClH
InChI:InChI=1S/C10H11F2N.ClH/c11-9-2-1-8(10(12)4-9)3-7-5-13-6-7;/h1-2,4,7,13H,3,5-6H2;1H
InChI key:InChIKey=KHQFWPNPCZVNMM-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=C(F)C=C1)C2CNC2.Cl
Synonyms:- 3-(2,4-Difluorobenzyl)azetidine hydrochloride
- Azetidine, 3-[(2,4-difluorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2,4-Difluorobenzyl)azetidine Hydrochloride
CAS:Controlled ProductApplications A 3-aryl substituted Azetidine (A813000) used in the preparation opioid receptor modulators.
Formula:C10H11F2N·HClColor and Shape:NeatMolecular weight:219.659
