CAS 1803600-40-9

1H-Indole, 2-(4-piperidinyl)-, hydrochloride (1:1)

Description:

1H-Indole, 2-(4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its indole core structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a piperidine substituent at the 2-position of the indole enhances its pharmacological properties, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including drug formulation. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems, and could be investigated for therapeutic uses. Its molecular structure contributes to its stability and reactivity, influencing its behavior in biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₃H₁₆N₂·ClH

InChI: InChI=1S/C13H16N2.ClH/c1-2-4-12-11(3-1)9-13(15-12)10-5-7-14-8-6-10;/h1-4,9-10,14-15H,5-8H2;1H

InChI key: InChIKey=QAGVRUYMCZIJPG-UHFFFAOYSA-N

SMILES: C1(=CC=2C(N1)=CC=CC2)C3CCNCC3.Cl

Synonyms:

• 1H-Indole, 2-(4-piperidinyl)-, hydrochloride (1:1)

2-(Piperidin-4-yl)-1H-indole hydrochloride

CAS: 1803600-40-9

Versatile small molecule scaffold

Formula: C₁₃H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 236.74 g/mol

Ref: 3D-DXC60040