CAS 1803600-73-8

Cyclopentanemethanamine, 1-(bromomethyl)-, hydrobromide (1:1)

Description:

Cyclopentanemethanamine, 1-(bromomethyl)-, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a bromomethyl group attached to a primary amine. This compound is typically encountered as a hydrobromide salt, indicating that it is protonated and stabilized by bromide ions. The presence of the bromomethyl group suggests potential reactivity, making it useful in various synthetic applications, particularly in organic chemistry. The hydrobromide form enhances its solubility in polar solvents, facilitating its use in laboratory settings. As with many amines, it may exhibit basic properties and can participate in nucleophilic substitution reactions. Safety considerations are essential when handling this compound, as brominated compounds can be hazardous. Overall, its structural features and reactivity profile make it a compound of interest in both academic research and industrial applications.

Formula: C₇H₁₄BrN·BrH

InChI: InChI=1S/C7H14BrN.BrH/c8-5-7(6-9)3-1-2-4-7;/h1-6,9H2;1H

InChI key: InChIKey=AXJAIWSLGYATBS-UHFFFAOYSA-N

SMILES: C(Br)C1(CN)CCCC1.Br

Synonyms:

• Cyclopentanemethanamine, 1-(bromomethyl)-, hydrobromide (1:1)

[1-(Bromomethyl)cyclopentyl]methanamine hydrobromide

CAS: 1803600-73-8

Versatile small molecule scaffold

Formula: C₇H₁₅Br₂N

Purity: Min. 95%

Molecular weight: 273.01 g/mol

Ref: 3D-DXC60073