CAS 1803600-75-0

Methyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-acetate

Description:

Methyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-acetate is a chemical compound characterized by its unique oxadiazole ring structure, which incorporates a trifluoromethyl group and an acetate moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity and applications in pharmaceuticals or agrochemicals. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making it a valuable feature in drug design. The oxadiazole ring contributes to the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. Methyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-acetate may also display moderate to high solubility in organic solvents, while its stability can vary depending on environmental conditions. As with many fluorinated compounds, it may exhibit unique physical and chemical properties, such as increased thermal stability and altered reactivity compared to non-fluorinated analogs. Overall, this compound represents a class of chemicals with significant potential in various applications, particularly in medicinal chemistry.

Formula: C₆H₅F₃N₂O₃

InChI: InChI=1S/C6H5F3N2O3/c1-13-4(12)2-3-10-11-5(14-3)6(7,8)9/h2H2,1H3

InChI key: InChIKey=MVRIEFLVQBCSLU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1OC(CC(OC)=O)=NN1

Synonyms:

• 1,3,4-Oxadiazole-2-acetic acid, 5-(trifluoromethyl)-, methyl ester
• Methyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-acetate

Methyl 2-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]acetate

CAS: 1803600-75-0

Versatile small molecule scaffold

Formula: C₆H₅F₃N₂O₃

Purity: Min. 95%

Molecular weight: 210.11 g/mol

Ref: 3D-DXC60075