CAS 1803600-87-4

Acetamide, 2-(methylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-, hydrochloride (1:2)

Description:

Acetamide, 2-(methylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes an acetamide functional group and a thiadiazole moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The presence of the methylamino group suggests potential basicity, while the thiadiazole ring may contribute to its biological activity, possibly influencing its pharmacological properties. As a hydrochloride salt, it is likely to exhibit enhanced stability and solubility compared to its free base form. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in treating various conditions. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies and literature review.

Formula: C₉H₁₆N₄OS·2ClH

InChI: InChI=1S/C9H16N4OS.2ClH/c1-6(2)4-8-12-13-9(15-8)11-7(14)5-10-3;;/h6,10H,4-5H2,1-3H3,(H,11,13,14);2*1H

InChI key: InChIKey=ZZGVKSHKKVFOIR-UHFFFAOYSA-N

SMILES: N(C(CNC)=O)C=1SC(CC(C)C)=NN1.Cl

Synonyms:

• Acetamide, 2-(methylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-, hydrochloride (1:2)

2-(Methylamino)-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]acetamide dihydrochloride

CAS: 1803600-87-4

Versatile small molecule scaffold

Formula: C₉H₁₈Cl₂N₄OS

Purity: Min. 95%

Molecular weight: 301.24 g/mol

Ref: 3D-DXC60087