CAS 1803601-39-9

1,2-Benzisothiazol-3(2H)-one, 6-fluoro-2-(methoxymethyl)-, 1,1-dioxide

Description:

1,2-Benzisothiazol-3(2H)-one, 6-fluoro-2-(methoxymethyl)-, 1,1-dioxide, identified by CAS number 1803601-39-9, is a synthetic organic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a thiazole moiety. This compound features a fluorine atom and a methoxymethyl group, which contribute to its chemical reactivity and potential applications. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom in the thiazole ring, enhancing its stability and solubility in various solvents. It is often studied for its antimicrobial properties and potential use in agricultural applications, particularly as a fungicide or bactericide. The compound's specific interactions and efficacy can vary based on its concentration and the environmental conditions in which it is applied. As with many synthetic chemicals, safety data and handling precautions are essential for its use in laboratory or industrial settings.

Formula: C₉H₈FNO₄S

InChI: InChI=1S/C9H8FNO4S/c1-15-5-11-9(12)7-3-2-6(10)4-8(7)16(11,13)14/h2-4H,5H2,1H3

InChI key: InChIKey=ZPHUDHQWCXQFME-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(C(=O)N1COC)=CC=C(F)C2

Synonyms:

• 1,2-Benzisothiazol-3(2H)-one, 6-fluoro-2-(methoxymethyl)-, 1,1-dioxide

6-Fluoro-2-(methoxymethyl)-2,3-dihydro-1,2-benzothiazole-1,1,3-trione

CAS: 1803601-39-9

Versatile small molecule scaffold

Formula: C₉H₈FNO₄S

Purity: Min. 95%

Molecular weight: 245.23 g/mol

Ref: 3D-DXC60139