CAS 1803601-45-7

Cyclohexanecarboxylic acid, 1-amino-4,4-dimethyl-, hydrochloride (1:1)

Description:

Cyclohexanecarboxylic acid, 1-amino-4,4-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclohexane ring structure with a carboxylic acid functional group and an amino group substituted at the 1-position. The presence of the dimethyl groups at the 4-position contributes to its steric properties and influences its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit basic properties due to the amino group, allowing it to participate in acid-base reactions. Its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Additionally, the compound's specific stereochemistry and functional groups may impart unique biological activities, making it of interest in medicinal chemistry. Overall, this compound's characteristics are defined by its functional groups, solubility, and potential reactivity in various chemical environments.

Formula: C₉H₁₇NO₂·ClH

InChI: InChI=1S/C9H17NO2.ClH/c1-8(2)3-5-9(10,6-4-8)7(11)12;/h3-6,10H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=HOEAITZTGWKERS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CCC(C)(C)CC1.Cl

Synonyms:

• Cyclohexanecarboxylic acid, 1-amino-4,4-dimethyl-, hydrochloride (1:1)

1-Amino-4,4-dimethylcyclohexane-1-carboxylic acid hydrochloride

CAS: 1803601-45-7

Versatile small molecule scaffold

Formula: C₉H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 207.7 g/mol

Ref: 3D-DXC60145