CAS 1803601-51-5

Piperidine, 2-(2-methylpropyl)-6-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Piperidine, 2-(2-methylpropyl)-6-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2-methylpropyl group and a trifluoromethyl group at specific positions on the piperidine ring contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and chemical synthesis. The trifluoromethyl group is known to impart lipophilicity and can influence the compound's interaction with biological targets. This compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its full profile. As with many piperidine derivatives, it may also serve as a building block for the synthesis of more complex molecules in organic chemistry.

Formula: C₁₀H₁₈F₃N·ClH

InChI: InChI=1S/C10H18F3N.ClH/c1-7(2)6-8-4-3-5-9(14-8)10(11,12)13;/h7-9,14H,3-6H2,1-2H3;1H

InChI key: InChIKey=HBGQJOGPQKUKSD-UHFFFAOYSA-N

SMILES: C(C(C)C)C1NC(C(F)(F)F)CCC1.Cl

Synonyms:

• Piperidine, 2-(2-methylpropyl)-6-(trifluoromethyl)-, hydrochloride (1:1)

2-(2-Methylpropyl)-6-(trifluoromethyl)piperidine hydrochloride

CAS: 1803601-51-5

Versatile small molecule scaffold

Formula: C₁₀H₁₉ClF₃N

Purity: Min. 95%

Molecular weight: 245.71 g/mol

Ref: 3D-DXC60151