CAS 1803601-79-7

Phenol, 4-(1H-1,2,3-triazol-5-yl)-, hydrobromide (1:1)

Description:

Phenol, 4-(1H-1,2,3-triazol-5-yl)-, hydrobromide (1:1) is a chemical compound characterized by its phenolic structure substituted with a 1H-1,2,3-triazole moiety. This compound typically exhibits properties associated with both phenols and triazoles, including potential antimicrobial and antifungal activities due to the presence of the triazole ring, which is known for its bioactivity. The hydrobromide form indicates that the compound is in a salt form, which can enhance its solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the bromide ion may also influence its reactivity and stability. As a phenolic compound, it may exhibit acidity due to the hydroxyl group, and its triazole component can participate in hydrogen bonding and coordination with metal ions. Overall, this compound's unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development.

Formula: C₈H₇N₃O·BrH

InChI: InChI=1S/C8H7N3O.BrH/c12-7-3-1-6(2-4-7)8-5-9-11-10-8;/h1-5,12H,(H,9,10,11);1H

InChI key: InChIKey=YXWBEJCWPBTNMO-UHFFFAOYSA-N

SMILES: OC1=CC=C(C=C1)C2=CN=NN2.Br

Synonyms:

• Phenol, 4-(1H-1,2,3-triazol-5-yl)-, hydrobromide (1:1)

4-(1H-1,2,3-Triazol-4-yl)phenol hydrobromide

CAS: 1803601-79-7

Versatile small molecule scaffold

Formula: C₈H₈BrN₃O

Purity: Min. 95%

Molecular weight: 242.07 g/mol

Ref: 3D-DXC60179