CAS 1803601-93-5

Hydrazine, [2-methyl-6-(1-methylethyl)phenyl]-, hydrochloride (1:1)

Description:

Hydrazine, [2-methyl-6-(1-methylethyl)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and potential as a reducing agent. This compound features a substituted phenyl ring, specifically with a methyl and isopropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of the hydrochloride indicates that it can form a stable ionic bond with hydrochloric acid, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical applications, although specific toxicity and safety data should be reviewed due to the potential hazards associated with hydrazine derivatives. Overall, its characteristics include a relatively low molecular weight, moderate volatility, and the potential for various chemical reactions, including those typical of hydrazines, such as oxidation and condensation reactions.

Formula: C₁₀H₁₆N₂·ClH

InChI: InChI=1S/C10H16N2.ClH/c1-7(2)9-6-4-5-8(3)10(9)12-11;/h4-7,12H,11H2,1-3H3;1H

InChI key: InChIKey=MCRHCSCVAAGBHX-UHFFFAOYSA-N

SMILES: N(N)C1=C(C(C)C)C=CC=C1C.Cl

Synonyms:

• Hydrazine, [2-methyl-6-(1-methylethyl)phenyl]-, hydrochloride (1:1)

[2-Methyl-6-(propan-2-yl)phenyl]hydrazine hydrochloride

CAS: 1803601-93-5

Versatile small molecule scaffold

Formula: C₁₀H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 200.71 g/mol

Ref: 3D-DXC60193