CAS 1803601-96-8

3-Pyridinecarboxylic acid, 4-phenoxy-, hydrochloride (1:1)

Description:

3-Pyridinecarboxylic acid, 4-phenoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and carboxylic acid functional groups, which contribute to its acidic properties. The presence of the phenoxy group enhances its potential for various chemical interactions, making it useful in pharmaceutical applications. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in biological systems. The compound may exhibit properties such as moderate to high polarity due to the presence of both the carboxylic acid and the pyridine nitrogen, influencing its reactivity and interaction with other molecules. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any risks associated with its use. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.

Formula: C₁₂H₉NO₃·ClH

InChI: InChI=1S/C12H9NO3.ClH/c14-12(15)10-8-13-7-6-11(10)16-9-4-2-1-3-5-9;/h1-8H,(H,14,15);1H

InChI key: InChIKey=CRWKNKKOGAKSKO-UHFFFAOYSA-N

SMILES: O(C=1C(C(O)=O)=CN=CC1)C2=CC=CC=C2.Cl

Synonyms:

• 3-Pyridinecarboxylic acid, 4-phenoxy-, hydrochloride (1:1)

4-Phenoxypyridine-3-carboxylic acid hydrochloride

CAS: 1803601-96-8

Versatile small molecule scaffold

Formula: C₁₂H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 251.66 g/mol

Ref: 3D-DXC60196