CAS 1803601-98-0

1-Azetidineacetic acid, 2-methyl-, hydrochloride (1:1)

Description:

1-Azetidineacetic acid, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. This compound features an acetic acid moiety, contributing to its acidic properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in various environments. Typically, such compounds may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the precise molecular interactions and the presence of functional groups. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.

Formula: C₆H₁₂ClNO₂

InChI: InChI=1S/C6H11NO2.ClH/c1-5-2-3-7(5)4-6(8)9;/h5H,2-4H2,1H3,(H,8,9);1H

InChI key: InChIKey=LDUZHEKMTAEMBZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(C)CC1.Cl

Synonyms:

• 1-Azetidineacetic acid, 2-methyl-, hydrochloride (1:1)
• 2-(2-methylazetidin-1-yl)acetic acid hydrochloride

2-(2-Methylazetidin-1-yl)acetic acid hydrochloride

CAS: 1803601-98-0

Versatile small molecule scaffold

Formula: C₆H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 165.62 g/mol

Ref: 3D-DXC60198