CAS 1803601-99-1

Carbamic acid, N-(1-methylethyl)-, 3-azetidinyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-(1-methylethyl)-, 3-azetidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a carbamic acid moiety and an azetidine ring. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the isopropyl group (1-methylethyl) contributes to its steric properties, potentially influencing its biological activity and interactions. As a hydrochloride salt, it exhibits enhanced stability and is often used in pharmaceutical applications. The compound may possess specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₇H₁₄N₂O₂·ClH

InChI: InChI=1S/C7H14N2O2.ClH/c1-5(2)9-7(10)11-6-3-8-4-6;/h5-6,8H,3-4H2,1-2H3,(H,9,10);1H

InChI key: InChIKey=HZJMMVMGOPKKMZ-UHFFFAOYSA-N

SMILES: O(C(NC(C)C)=O)C1CNC1.Cl

Synonyms:

• Carbamic acid, N-(1-methylethyl)-, 3-azetidinyl ester, hydrochloride (1:1)
• Azetidin-3-yl N-(propan-2-yl)carbamate hydrochloride

Azetidin-3-yl N-(propan-2-yl)carbamate hydrochloride

CAS: 1803601-99-1

Versatile small molecule scaffold

Formula: C₇H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 194.66 g/mol

Ref: 3D-DXC60199