CAS 1803602-02-9

4-Hydroxy-1-methyl-1H-pyrazole-3,5-dicarboxylic acid

Description:

4-Hydroxy-1-methyl-1H-pyrazole-3,5-dicarboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which contains two carboxylic acid functional groups and a hydroxyl group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the carboxylic acid and hydroxyl groups, which can engage in hydrogen bonding. The presence of these functional groups also suggests potential acidity, allowing it to act as a weak acid in solution. The methyl group attached to the pyrazole ring contributes to its overall stability and influences its reactivity. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to act as a building block in synthetic chemistry. Its specific applications and interactions would depend on further studies and evaluations of its chemical behavior and biological properties.

Formula: C₆H₆N₂O₅

InChI: InChI=1S/C6H6N2O5/c1-8-3(6(12)13)4(9)2(7-8)5(10)11/h9H,1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=GKFAQEIITJIACL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C(C(O)=O)=NN1C

Synonyms:

• 1H-Pyrazole-3,5-dicarboxylic acid, 4-hydroxy-1-methyl-
• 4-Hydroxy-1-methyl-1H-pyrazole-3,5-dicarboxylic acid

4-Hydroxy-1-methyl-1H-pyrazole-3,5-dicarboxylic acid

CAS: 1803602-02-9

Versatile small molecule scaffold

Formula: C₆H₆N₂O₅

Purity: Min. 95%

Molecular weight: 186.12 g/mol

Ref: 3D-DXC60202