CAS 1803602-20-1

Piperidine, 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a 2-bromophenyl group and a 1,2,4-oxadiazole moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom may influence its reactivity and interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests potential for diverse applications in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₄BrN₃O·ClH

InChI: InChI=1S/C13H14BrN3O.ClH/c14-11-4-2-1-3-10(11)12-16-13(18-17-12)9-5-7-15-8-6-9;/h1-4,9,15H,5-8H2;1H

InChI key: InChIKey=NBLDBFDAPHDTFQ-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1)C=2N=C(ON2)C3CCNCC3.Cl

Synonyms:

• Piperidine, 4-[3-(2-bromophenyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

4-[3-(2-Bromophenyl)-1,2,4-oxadiazol-5-yl]piperidine hydrochloride

CAS: 1803602-20-1

Versatile small molecule scaffold

Formula: C₁₃H₁₅BrClN₃O

Purity: Min. 95%

Molecular weight: 344.63 g/mol

Ref: 3D-DXC60220