CAS 1803603-35-1

Pyrazino[2,1-c][1,4]thiazine, octahydro-, 2,2-dioxide, hydrochloride (1:2)

Description:

Pyrazino[2,1-c][1,4]thiazine, octahydro-, 2,2-dioxide, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazine and thiazine moieties. This compound typically exhibits a high degree of solubility in polar solvents due to the presence of the hydrochloride salt form, which enhances its ionic character. The octahydro configuration indicates that the compound is fully saturated, contributing to its stability and potentially influencing its biological activity. The 2,2-dioxide functional group suggests the presence of two carbonyl oxygen atoms, which may play a role in its reactivity and interactions with biological targets. This compound may be of interest in pharmaceutical research, particularly for its potential therapeutic applications, although specific biological activities would need to be investigated further. As with many chemical substances, safety data and handling precautions should be adhered to, given the potential for toxicity or reactivity.

Formula: C₇H₁₄N₂O₂S·2ClH

InChI: InChI=1S/C7H14N2O2S.2ClH/c10-12(11)4-3-9-2-1-8-5-7(9)6-12;;/h7-8H,1-6H2;2*1H

InChI key: InChIKey=FGYAEQMDXNKWQQ-UHFFFAOYSA-N

SMILES: O=S1(=O)CC2N(CC1)CCNC2.Cl

Synonyms:

• Pyrazino[2,1-c][1,4]thiazine, octahydro-, 2,2-dioxide, hydrochloride (1:2)

Octahydro-pyrazino[2,​1-​c]​[1,​4]​thiazine 2,​2-​dioxide hydrochloride

CAS: 1803603-35-1

Versatile small molecule scaffold

Formula: C₇H₁₆Cl₂N₂O₂S

Purity: Min. 95%

Molecular weight: 263.18 g/mol

Ref: 3D-DXC60335