CAS 1803603-71-5

Cyclobutanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

Cyclobutanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its cyclobutane ring structure, which is a four-membered saturated cyclic hydrocarbon. The presence of a 4-chlorobenzyl group indicates that a chlorinated phenyl group is attached to the nitrogen atom of the cyclobutanamine, enhancing its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed studies on its biological activity and toxicity would be necessary to fully understand its characteristics. The molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. As with many amines, it may also exhibit basicity, allowing it to form salts with acids, which is a common feature in drug development to improve solubility and stability.

Formula: C₁₁H₁₄ClN·ClH

InChI: InChI=1S/C11H14ClN.ClH/c12-10-4-2-9(3-5-10)8-11(13)6-1-7-11;/h2-5H,1,6-8,13H2;1H

InChI key: InChIKey=RQLFYDMPQJWRMK-UHFFFAOYSA-N

SMILES: C(C1(N)CCC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• Cyclobutanamine, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

1-[(4-Chlorophenyl)methyl]cyclobutan-1-amine hydrochloride

CAS: 1803603-71-5

Versatile small molecule scaffold

Formula: C₁₁H₁₅Cl₂N

Purity: Min. 95%

Molecular weight: 232.15 g/mol

Ref: 3D-DXC60371