CAS 1803603-80-6

Cyclobutanemethanamine, N-(1-methylethyl)-, hydrochloride (1:1)

Description:

Cyclobutanemethanamine, N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclobutane ring structure. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of the N-(1-methylethyl) substituent indicates that the compound has an isopropyl group attached to the nitrogen atom, which can influence its steric and electronic properties. This compound may exhibit basicity due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as amines are often key components in drug design. Additionally, the hydrochloride form can enhance the compound's bioavailability and facilitate its use in biological systems. Overall, the characteristics of this compound make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₈H₁₇N·ClH

InChI: InChI=1S/C8H17N.ClH/c1-7(2)9-6-8-4-3-5-8;/h7-9H,3-6H2,1-2H3;1H

InChI key: InChIKey=OMRSQWNDTWSQPI-UHFFFAOYSA-N

SMILES: C(NC(C)C)C1CCC1.Cl

Synonyms:

• Cyclobutanemethanamine, N-(1-methylethyl)-, hydrochloride (1:1)

(Cyclobutylmethyl)(propan-2-yl)amine hydrochloride

CAS: 1803603-80-6

Versatile small molecule scaffold

Formula: C₈H₁₈ClN

Purity: Min. 95%

Molecular weight: 163.69 g/mol

Ref: 3D-DXC60380