CAS 1803603-81-7

5-Azaspiro[3.5]nonan-6-one, 9-amino-

Description:

5-Azaspiro[3.5]nonan-6-one, 9-amino- is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom integrated into the spiro framework. This compound features a ketone functional group at the 6-position and an amino group at the 9-position, contributing to its potential reactivity and biological activity. The presence of the azaspiro moiety suggests interesting conformational properties and may influence its interactions with biological targets. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as pharmacological agents, particularly in the development of drugs targeting various diseases. The specific stereochemistry and substituents can significantly affect the compound's properties, including solubility, stability, and biological activity. As with many nitrogen-containing heterocycles, 5-Azaspiro[3.5]nonan-6-one, 9-amino- may exhibit diverse chemical behaviors, making it a subject of interest for further research in synthetic and medicinal chemistry.

Formula: C₈H₁₄N₂O

InChI: InChI=1S/C8H14N2O/c9-6-2-3-7(11)10-8(6)4-1-5-8/h6H,1-5,9H2,(H,10,11)

InChI key: InChIKey=XKJCZOVDARJKFM-UHFFFAOYSA-N

SMILES: NC1C2(NC(=O)CC1)CCC2

Synonyms:

• 9-Amino-5-azaspiro[3.5]nonan-6-one
• 5-Azaspiro[3.5]nonan-6-one, 9-amino-

9-Amino-5-azaspiro[3.5]nonan-6-one

CAS: 1803603-81-7

Versatile small molecule scaffold

Formula: C₈H₁₄N₂O

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-DXC60381