CAS 1803604-09-2

Carbamic acid, N-(1-methylethyl)-, 2-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-(1-methylethyl)-, 2-piperidinylmethyl ester, hydrochloride (1:1), with the CAS number 1803604-09-2, is a chemical compound characterized by its structure, which includes a carbamic acid moiety and a piperidine ring. This compound typically appears as a white to off-white solid and is soluble in water, reflecting its hydrochloride salt form. The presence of the piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential inhibitor or modulator of certain biological pathways, although specific pharmacological effects would depend on further empirical studies. Its synthesis involves the reaction of isopropyl amine derivatives with carbamic acid esters, followed by hydrochloride salt formation. As with many chemical substances, safety data should be consulted, as it may pose risks if not handled properly. Overall, this compound represents a class of substances that could have applications in pharmaceuticals or agrochemicals, pending further research into its efficacy and safety profile.

Formula: C₁₀H₂₀N₂O₂·ClH

InChI: InChI=1S/C10H20N2O2.ClH/c1-8(2)12-10(13)14-7-9-5-3-4-6-11-9;/h8-9,11H,3-7H2,1-2H3,(H,12,13);1H

InChI key: InChIKey=LUCLUFGRENKERG-UHFFFAOYSA-N

SMILES: C(OC(NC(C)C)=O)C1CCCCN1.Cl

Synonyms:

• Carbamic acid, N-(1-methylethyl)-, 2-piperidinylmethyl ester, hydrochloride (1:1)
• Piperidin-2-ylmethyl N-(propan-2-yl)carbamate hydrochloride

Piperidin-2-ylmethyl N-(propan-2-yl)carbamate hydrochloride

CAS: 1803604-09-2

Versatile small molecule scaffold

Formula: C₁₀H₂₁ClN₂O₂

Purity: Min. 95%

Molecular weight: 236.74 g/mol

Ref: 3D-DXC60409