CAS 1803604-16-1

Carbamic acid, N-cyclohexyl-, 2-pyrrolidinylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-cyclohexyl-, 2-pyrrolidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a carbamic acid moiety and a cyclohexyl group, along with a pyrrolidinylmethyl ester. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. Its molecular structure suggests potential applications in medicinal chemistry, particularly as a pharmacological agent, given the presence of the pyrrolidine ring, which is often associated with various biological activities. The hydrochloride form enhances its stability and solubility, making it suitable for formulation in pharmaceutical applications. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of carbamate derivatives that may exhibit interesting biological properties, warranting further investigation in drug development and therapeutic applications.

Formula: C₁₂H₂₂N₂O₂·ClH

InChI: InChI=1S/C12H22N2O2.ClH/c15-12(14-10-5-2-1-3-6-10)16-9-11-7-4-8-13-11;/h10-11,13H,1-9H2,(H,14,15);1H

InChI key: InChIKey=SVBULVBENZLSOT-UHFFFAOYSA-N

SMILES: C(OC(NC1CCCCC1)=O)C2CCCN2.Cl

Synonyms:

• Carbamic acid, N-cyclohexyl-, 2-pyrrolidinylmethyl ester, hydrochloride (1:1)
• Pyrrolidin-2-ylmethyl N-cyclohexylcarbamate hydrochloride

Pyrrolidin-2-ylmethyl N-cyclohexylcarbamate hydrochloride

CAS: 1803604-16-1

Versatile small molecule scaffold

Formula: C₁₂H₂₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 262.77 g/mol

Ref: 3D-DXC60416