CAS 1803604-24-1

1H-Imidazole-2-methanamine, α-methyl-1-phenyl-, hydrochloride (1:1)

Description:

1H-Imidazole-2-methanamine, α-methyl-1-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an α-methyl group and a phenyl group attached to the imidazole, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the imidazole moiety suggests potential interactions with biological systems, particularly in enzyme catalysis and receptor binding. The compound may exhibit basic properties due to the nitrogen atoms in the imidazole ring, allowing it to participate in protonation and deprotonation reactions. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular interactions and the environment in which it is used. Overall, this compound is of interest in medicinal chemistry and could serve as a scaffold for drug development.

Formula: C₁₁H₁₃N₃·ClH

InChI: InChI=1S/C11H13N3.ClH/c1-9(12)11-13-7-8-14(11)10-5-3-2-4-6-10;/h2-9H,12H2,1H3;1H

InChI key: InChIKey=PCNLWRSMAKQSSL-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N(C=CN1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-Imidazole-2-methanamine, α-methyl-1-phenyl-, hydrochloride (1:1)

1-(1-Phenyl-1H-imidazol-2-yl)ethan-1-amine hydrochloride

CAS: 1803604-24-1

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClN₃

Purity: Min. 95%

Molecular weight: 223.7 g/mol

Ref: 3D-DXC60424