CAS 1803604-48-9

4-Morpholinecarboximidamide, 3-methyl-, sulfate (2:1)

Description:

4-Morpholinecarboximidamide, 3-methyl-, sulfate (2:1) is a chemical compound characterized by its morpholine and carboximidamide functional groups, which contribute to its unique properties. This substance typically appears as a white to off-white solid and is soluble in water due to the presence of the sulfate moiety, which enhances its hydrophilicity. The morpholine ring provides a cyclic structure that can participate in various chemical interactions, while the carboximidamide group may exhibit basic properties, allowing it to act as a potential ligand in coordination chemistry. The sulfate component indicates that the compound may have applications in biological systems, possibly as a pharmaceutical agent or in biochemical research. Its specific interactions and reactivity can be influenced by the presence of the methyl group, which can affect steric hindrance and electronic properties. Overall, this compound's characteristics make it of interest in both synthetic chemistry and potential therapeutic applications, although detailed studies would be necessary to fully elucidate its behavior and utility in various contexts.

Formula: C₆H₁₃N₃OH₂O₄S

InChI: InChI=1S/C6H13N3O.H2O4S/c1-5-4-10-3-2-9(5)6(7)8;1-5(2,3)4/h5H,2-4H2,1H3,(H3,7,8);(H2,1,2,3,4)

InChI key: InChIKey=NZYJUDRWBLVWIV-UHFFFAOYSA-N

SMILES: C(=N)(N)N1C(C)COCC1.S(=O)(=O)(O)O

Synonyms:

• 4-Morpholinecarboximidamide, 3-methyl-, sulfate (2:1)
• Bis(3-methylmorpholine-4-carboximidamide); sulfuric acid

Bis(3-methylmorpholine-4-carboximidamide), sulfuric acid

CAS: 1803604-48-9

Versatile small molecule scaffold

Formula: C₁₂H₂₈N₆O₆S

Purity: Min. 95%

Molecular weight: 384.46 g/mol

Ref: 3D-DXC60448