CAS 1803604-60-5

Benzothiazole, 2-(4-methyl-4-piperidinyl)-, hydrochloride (1:1)

Description:

Benzothiazole, 2-(4-methyl-4-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a piperidine ring substituted with a methyl group. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. Benzothiazole derivatives are known for their biological activities, including potential antimicrobial and antifungal properties. The piperidine group contributes to its pharmacological profile, potentially influencing its interaction with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound is of interest in medicinal chemistry and materials science due to its structural features and potential applications.

Formula: C₁₃H₁₆N₂S·ClH

InChI: InChI=1S/C13H16N2S.ClH/c1-13(6-8-14-9-7-13)12-15-10-4-2-3-5-11(10)16-12;/h2-5,14H,6-9H2,1H3;1H

InChI key: InChIKey=DJIHPROZEAUQQU-UHFFFAOYSA-N

SMILES: CC1(CCNCC1)C2=NC=3C(S2)=CC=CC3.Cl

Synonyms:

• Benzothiazole, 2-(4-methyl-4-piperidinyl)-, hydrochloride (1:1)

2-(4-Methylpiperidin-4-yl)-1,3-benzothiazole hydrochloride

CAS: 1803604-60-5

Versatile small molecule scaffold

Formula: C₁₃H₁₇ClN₂S

Purity: Min. 95%

Molecular weight: 268.81 g/mol

Ref: 3D-DXC60460