CAS 1803604-88-7

Methyl 2-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate

Description:

Methyl 2-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate is a bicyclic organic compound characterized by its unique bicyclo[2.2.1]heptane structure, which features a fused ring system. The presence of a methoxycarbonyl group (methyl ester) at the 2-position and an oxabicyclic framework contributes to its chemical reactivity and potential applications in organic synthesis. This compound typically exhibits moderate polarity due to the ester functional group, influencing its solubility in various organic solvents. Its molecular structure suggests potential for interesting stereochemistry and reactivity, making it a candidate for further study in fields such as medicinal chemistry and materials science. Additionally, the compound's CAS number, 1803604-88-7, allows for easy identification and retrieval of data related to its properties, synthesis, and applications in scientific literature. Overall, Methyl 2-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate represents a valuable structure for research and development in organic chemistry.

Formula: C₉H₁₄O₃

InChI: InChI=1S/C9H14O3/c1-9(8(10)11-2)5-6-3-4-7(9)12-6/h6-7H,3-5H2,1-2H3

InChI key: InChIKey=SBLXMYJPOAWQAR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(C)C2OC(C1)CC2

Synonyms:

• 7-Oxabicyclo[2.2.1]heptane-2-carboxylic acid, 2-methyl-, methyl ester
• Methyl 2-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate

Methyl 2-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate

CAS: 1803604-88-7

Versatile small molecule scaffold

Formula: C₉H₁₄O₃

Purity: Min. 95%

Molecular weight: 170.21 g/mol

Ref: 3D-DXC60488