CAS 1803604-94-5

3-Azetidineacetonitrile, 3-hydroxy-, hydrochloride (1:1)

Description:

3-Azetidineacetonitrile, 3-hydroxy-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of a hydroxy group indicates that it has alcohol functionality, contributing to its potential reactivity and solubility in polar solvents. The hydrochloride form suggests that the compound is a salt, enhancing its stability and solubility in aqueous solutions, which is often beneficial for pharmaceutical applications. The acetonitrile moiety indicates that the compound may exhibit properties typical of nitriles, such as being a potential precursor in organic synthesis or having specific biological activities. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological activity, toxicity, and potential applications.

Formula: C₅H₈N₂O·ClH

InChI: InChI=1S/C5H8N2O.ClH/c6-2-1-5(8)3-7-4-5;/h7-8H,1,3-4H2;1H

InChI key: InChIKey=XNUFGBMCCMVRGC-UHFFFAOYSA-N

SMILES: C(C#N)C1(O)CNC1.Cl

Synonyms:

• 3-Azetidineacetonitrile, 3-hydroxy-, hydrochloride (1:1)

2-(3-Hydroxyazetidin-3-yl)acetonitrile hydrochloride

CAS: 1803604-94-5

Versatile small molecule scaffold

Formula: C₅H₉ClN₂O

Purity: Min. 95%

Molecular weight: 148.59 g/mol

Ref: 3D-DXC60494