CAS 1803605-66-4

1-Piperidineethanamine, 2,5-dimethyl-, hydrochloride (1:2)

Description:

1-Piperidineethanamine, 2,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethylamine functional groups, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of two methyl groups at the 2 and 5 positions of the piperidine ring influences its steric and electronic properties, potentially affecting its interaction with biological targets. This compound may exhibit properties such as being a potential neurotransmitter modulator or having implications in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding, which is significant for its solubility and reactivity. Safety and handling precautions are essential, as with many amines and their salts, due to potential irritant effects. Further research is necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₉H₂₀N₂·2ClH

InChI: InChI=1S/C9H20N2.2ClH/c1-8-3-4-9(2)11(7-8)6-5-10;;/h8-9H,3-7,10H2,1-2H3;2*1H

InChI key: InChIKey=WVXLDDQNIIUXJU-UHFFFAOYSA-N

SMILES: C(CN)N1C(C)CCC(C)C1.Cl

Synonyms:

• 1-Piperidineethanamine, 2,5-dimethyl-, hydrochloride (1:2)

2-(2,5-Dimethylpiperidin-1-yl)ethan-1-amine dihydrochloride

CAS: 1803605-66-4

Versatile small molecule scaffold

Formula: C₉H₂₂Cl₂N₂

Purity: Min. 95%

Molecular weight: 229.19 g/mol

Ref: 3D-DXC60566