CAS 1803606-03-2

Benzenepropanoic acid, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1)

Description:

Benzenepropanoic acid, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzene ring, a propanoic acid moiety, and an aminomethyl group, along with a fluorine atom at the 3-position of the benzene ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the amino group suggests potential for biological activity, making it of interest in pharmaceutical research. The fluorine atom can influence the compound's electronic properties and lipophilicity, potentially affecting its interaction with biological targets. As a hydrochloride, it is likely to exhibit stability under standard conditions, but specific handling and storage guidelines should be followed to maintain its integrity. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields, where its properties can be exploited for therapeutic purposes.

Formula: C₁₀H₁₂FNO₂·ClH

InChI: InChI=1S/C10H12FNO2.ClH/c11-9-3-1-2-7(5-9)4-8(6-12)10(13)14;/h1-3,5,8H,4,6,12H2,(H,13,14);1H

InChI key: InChIKey=WQNSAABVNRZINP-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=CC(F)=CC=C1.Cl

Synonyms:

• Benzenepropanoic acid, α-(aminomethyl)-3-fluoro-, hydrochloride (1:1)
• 3-amino-2-[(3-fluorophenyl)methyl]propanoic acid hydrochloride

3-Amino-2-[(3-fluorophenyl)methyl]propanoic acid hydrochloride

CAS: 1803606-03-2

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClFNO₂

Purity: Min. 95%

Molecular weight: 233.67 g/mol

Ref: 3D-DXC60603