CAS 1803606-23-6

Benzenemethanamine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1), also known by its CAS number 1803606-23-6, is a chemical compound characterized by its amine functional group and a methoxy substituent on a benzene ring. This compound features a complex structure that includes a primary amine linked to a benzene ring, which is further substituted with a methoxy group and a 3-methylphenyl moiety. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity, while the aromatic rings contribute to its stability and potential interactions in biological systems. This compound may exhibit properties relevant to medicinal chemistry, including potential activity as a neurotransmitter modulator or in other therapeutic areas. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-12-3-2-4-14(9-12)11-17-15-7-5-13(10-16)6-8-15;/h2-9H,10-11,16H2,1H3;1H

InChI key: InChIKey=HCTJKKSPGMUKGF-UHFFFAOYSA-N

SMILES: O(CC1=CC(C)=CC=C1)C2=CC=C(CN)C=C2.Cl

Synonyms:

• Benzenemethanamine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1)

{4-[(3-Methylphenyl)methoxy]phenyl}methanamine hydrochloride

CAS: 1803606-23-6

Versatile small molecule scaffold

Formula: C₁₅H₁₈ClNO

Purity: Min. 95%

Molecular weight: 263.76 g/mol

Ref: 3D-DXC60623