CAS 1803606-31-6

Butanoic acid, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,2-dimethyl-, 1-methylethyl ester

Description:

Butanoic acid, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,2-dimethyl-, 1-methylethyl ester is an organic compound characterized by its ester functional group, which is derived from butanoic acid. This compound features a complex structure that includes a tert-butyl group and a dimethylsilyl ether, contributing to its unique chemical properties. The presence of the silyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical applications. The ester linkage indicates that it can undergo hydrolysis to regenerate the corresponding acid and alcohol. Additionally, the branched alkyl groups in its structure may influence its physical properties, such as boiling point and viscosity. This compound may also exhibit specific reactivity patterns typical of esters, including participation in nucleophilic substitution reactions. Overall, its unique structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a specialty chemical in various industrial processes.

Formula: C₁₅H₃₂O₃Si

InChI: InChI=1S/C15H32O3Si/c1-12(2)18-13(16)15(6,7)10-11-17-19(8,9)14(3,4)5/h12H,10-11H2,1-9H3

InChI key: InChIKey=YMBBKEHYJQIRPN-UHFFFAOYSA-N

SMILES: C(C(C(OC(C)C)=O)(C)C)CO[Si](C(C)(C)C)(C)C

Synonyms:

• 1-Methylethyl 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,2-dimethylbutanoate
• Butanoic acid, 4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,2-dimethyl-, 1-methylethyl ester

Propan-2-yl 4-[(tert-butyldimethylsilyl)oxy]-2,2-dimethylbutanoate

CAS: 1803606-31-6

Versatile small molecule scaffold

Formula: C₁₅H₃₂O₃Si

Purity: Min. 95%

Molecular weight: 288.5 g/mol

Ref: 3D-DXC60631