CAS 1803606-32-7

1-Piperidineethanamine, 2,4-dimethyl-, hydrochloride (1:2)

Description:

1-Piperidineethanamine, 2,4-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and ethanamine functional groups, along with two methyl substituents on the 2 and 4 positions of the aromatic ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and chemical research. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in numerous bioactive compounds. The hydrochloride form indicates that the compound is protonated, which can influence its stability, reactivity, and interaction with biological systems. As with many amines, it may exhibit basic properties, allowing it to participate in acid-base reactions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, applications, and safety profile in specific contexts.

Formula: C₉H₂₀N₂·2ClH

InChI: InChI=1S/C9H20N2.2ClH/c1-8-3-5-11(6-4-10)9(2)7-8;;/h8-9H,3-7,10H2,1-2H3;2*1H

InChI key: InChIKey=HNHWHDARSYHLQI-UHFFFAOYSA-N

SMILES: C(CN)N1C(C)CC(C)CC1.Cl

Synonyms:

• 1-Piperidineethanamine, 2,4-dimethyl-, hydrochloride (1:2)

2-(2,4-Dimethylpiperidin-1-yl)ethan-1-amine dihydrochloride

CAS: 1803606-32-7

Versatile small molecule scaffold

Formula: C₉H₂₂Cl₂N₂

Purity: Min. 95%

Molecular weight: 229.19 g/mol

Ref: 3D-DXC60632