CAS 1803606-64-5

3-Furanmethanamine, tetrahydro-2-(1-methylethyl)-, hydrochloride (1:1)

Description:

3-Furanmethanamine, tetrahydro-2-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a tetrahydrofuran moiety, indicating a saturated derivative of furan, and is substituted with an isopropyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine functional group suggests potential basicity and reactivity, allowing for interactions with acids and other electrophiles. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions of use and the presence of other substances. Overall, this compound represents a class of organic molecules that could have diverse applications in research and industry.

Formula: C₈H₁₇NO·ClH

InChI: InChI=1S/C8H17NO.ClH/c1-6(2)8-7(5-9)3-4-10-8;/h6-8H,3-5,9H2,1-2H3;1H

InChI key: InChIKey=MCEGSBCXNOYTJR-UHFFFAOYSA-N

SMILES: C(N)C1C(C(C)C)OCC1.Cl

Synonyms:

• 3-Furanmethanamine, tetrahydro-2-(1-methylethyl)-, hydrochloride (1:1)

[2-(Propan-2-yl)oxolan-3-yl]methanamine Hydrochloride (Mixture of Diastereomers)

Controlled Product

CAS: 1803606-64-5

Formula: C₈H₁₇NO·HCl

Color and Shape: Neat

Molecular weight: 179.688

Ref: TR-B524998

[2-(Propan-2-yl)oxolan-3-yl]methanamine hydrochloride

CAS: 1803606-64-5

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO

Purity: Min. 95%

Molecular weight: 179.69 g/mol

Ref: 3D-DXC60664