CAS 1803607-19-3

Hydrazinecarboxamide, N-(3-aminophenyl)-2,2-dimethyl-, hydrochloride (1:2)

Description:

Hydrazinecarboxamide, N-(3-aminophenyl)-2,2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine and carboxamide functional groups, along with an aromatic amine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, which is common for hydrochloride salts. The presence of the 3-aminophenyl group suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The compound's hydrochloride form indicates that it is a salt, which often enhances its stability and solubility compared to its free base form. As with many hydrazine derivatives, it may exhibit biological activity, including potential anti-cancer or anti-inflammatory properties, although specific biological data would be necessary to confirm such effects. Safety considerations are important, as hydrazine derivatives can be toxic and require careful handling. Overall, this compound represents a class of chemicals with diverse applications in medicinal chemistry and material science.

Formula: C₉H₁₄N₄O·2ClH

InChI: InChI=1S/C9H14N4O.2ClH/c1-13(2)12-9(14)11-8-5-3-4-7(10)6-8;;/h3-6H,10H2,1-2H3,(H2,11,12,14);2*1H

InChI key: InChIKey=XQVNIXATEIMQIW-UHFFFAOYSA-N

SMILES: N(C(NN(C)C)=O)C1=CC(N)=CC=C1.Cl

Synonyms:

• Hydrazinecarboxamide, N-(3-aminophenyl)-2,2-dimethyl-, hydrochloride (1:2)

1-(3-Aminophenyl)-3-(dimethylamino)urea dihydrochloride

CAS: 1803607-19-3

Versatile small molecule scaffold

Formula: C₉H₁₆Cl₂N₄O

Purity: Min. 95%

Molecular weight: 267.15 g/mol

Ref: 3D-DXC60719