CAS 1803607-49-9

Benzenamine, 3,5-diiodo-, hydrochloride (1:1)

Description:

Benzenamine, 3,5-diiodo-, hydrochloride (1:1) is an organic compound characterized by the presence of a benzene ring substituted with two iodine atoms at the 3 and 5 positions, along with an amino group (-NH2) that defines it as an aniline derivative. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound typically exhibits properties associated with aromatic amines, including potential biological activity and reactivity due to the presence of the amino group. The iodine substituents can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. As a hydrochloride salt, it is likely to be a white crystalline solid, and it may be used in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as iodine-containing compounds can pose health risks, and the amine group may have specific reactivity considerations.

Formula: C₆H₅I₂N·ClH

InChI: InChI=1S/C6H5I2N.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3H,9H2;1H

InChI key: InChIKey=RHDJEFVGAYDZOM-UHFFFAOYSA-N

SMILES: IC1=CC(I)=CC(N)=C1.Cl

Synonyms:

• Benzenamine, 3,5-diiodo-, hydrochloride (1:1)

3,5-Diiodoaniline hydrochloride

CAS: 1803607-49-9

Versatile small molecule scaffold

Formula: C₆H₆ClI₂N

Purity: Min. 95%

Molecular weight: 381.38 g/mol

Ref: 3D-DXC60749