CAS 1803607-59-1

Azetidine, 3-cyclopentyl-, hydrochloride (1:1)

Description:

Azetidine, 3-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a cyclopentyl group at the 3-position of the azetidine ring contributes to its unique properties, including potential steric and electronic effects that can influence its reactivity and interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting central nervous system disorders or other therapeutic areas. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and potential uses in clinical settings.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c1-2-4-7(3-1)8-5-9-6-8;/h7-9H,1-6H2;1H

InChI key: InChIKey=HPWCMERKLYRYTC-UHFFFAOYSA-N

SMILES: C1(CNC1)C2CCCC2.Cl

Synonyms:

• Azetidine, 3-cyclopentyl-, hydrochloride (1:1)

3-Cyclopentylazetidine hydrochloride

CAS: 1803607-59-1

Versatile small molecule scaffold

Formula: C₈H₁₆ClN

Purity: Min. 95%

Molecular weight: 161.67 g/mol

Ref: 3D-DXC60759