CAS 1803607-60-4

Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-α-methyl-3-azetidineacetate

Description:

Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-α-methyl-3-azetidineacetate is a chemical compound characterized by its unique structure, which includes an azetidine ring, an ester functional group, and a tert-butyl substituent. This compound is likely to exhibit properties typical of azetidine derivatives, such as potential biological activity and reactivity due to the presence of the azetidine nitrogen atom. The ester group suggests that it may be involved in hydrolysis reactions, making it relevant in synthetic organic chemistry. Additionally, the presence of the bulky 1,1-dimethylethoxy group may influence its steric properties and solubility in various solvents. The compound's molecular structure indicates potential applications in pharmaceuticals or agrochemicals, where azetidine derivatives are often explored for their biological activities. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from literature for a comprehensive understanding of its characteristics.

Formula: C₁₃H₂₃NO₄

InChI: InChI=1S/C13H23NO4/c1-6-17-11(15)9(2)10-7-14(8-10)12(16)18-13(3,4)5/h9-10H,6-8H2,1-5H3

InChI key: InChIKey=FVKWZYRQZCTBMJ-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(C(C(OCC)=O)C)C1

Synonyms:

• 3-Azetidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-α-methyl-, ethyl ester
• Ethyl 1-[(1,1-dimethylethoxy)carbonyl]-α-methyl-3-azetidineacetate

tert-Butyl 3-(1-ethoxy-1-oxopropan-2-yl)azetidine-1-carboxylate

CAS: 1803607-60-4

Versatile small molecule scaffold

Formula: C₁₃H₂₃NO₄

Purity: Min. 95%

Molecular weight: 257.33 g/mol

Ref: 3D-DXC60760