CAS 1803607-61-5

2-Pyridineethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)

Description:

2-Pyridineethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and amine functional groups, which contribute to its basicity and potential reactivity. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on its structure and the context of use. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₈H₉F₃N₂·ClH

InChI: InChI=1S/C8H9F3N2.ClH/c9-8(10,11)6-2-4-13-7(5-6)1-3-12;/h2,4-5H,1,3,12H2;1H

InChI key: InChIKey=MPIVYTFMYHWFAG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(CCN)N=CC1.Cl

Synonyms:

• 2-Pyridineethanamine, 4-(trifluoromethyl)-, hydrochloride (1:1)

2-[4-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine hydrochloride

CAS: 1803607-61-5

Versatile small molecule scaffold

Formula: C₈H₁₀ClF₃N₂

Purity: Min. 95%

Molecular weight: 226.62 g/mol

Ref: 3D-DXC60761