CAS 1803607-65-9

5-Isoxazolecarboxylic acid, 3-(1-amino-1-methylethyl)-, methyl ester, hydrochloride (1:1)

Description:

5-Isoxazolecarboxylic acid, 3-(1-amino-1-methylethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. This compound features a carboxylic acid functional group, an amino group, and a methyl ester, indicating potential for various chemical interactions and biological activities. The hydrochloride form suggests that it is a salt, which can enhance its solubility in aqueous solutions, making it suitable for pharmaceutical applications. The presence of the isoxazole moiety may impart specific pharmacological properties, potentially influencing its role in medicinal chemistry. Additionally, the compound's molecular structure allows for interactions with biological targets, which could be relevant in drug development. Its CAS number, 1803607-65-9, provides a unique identifier for regulatory and research purposes. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₈H₁₂N₂O₃·ClH

InChI: InChI=1S/C8H12N2O3.ClH/c1-8(2,9)6-4-5(13-10-6)7(11)12-3;/h4H,9H2,1-3H3;1H

InChI key: InChIKey=NNKLUOBXFHPHFG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(C(C)(C)N)=NO1.Cl

Synonyms:

• 5-Isoxazolecarboxylic acid, 3-(1-amino-1-methylethyl)-, methyl ester, hydrochloride (1:1)

Methyl 3-(2-aminopropan-2-yl)-1,2-oxazole-5-carboxylate hydrochloride

CAS: 1803607-65-9

Versatile small molecule scaffold

Formula: C₈H₁₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 220.65 g/mol

Ref: 3D-DXC60765