CAS 1803607-73-9

2H-Pyran-3-amine, 3-[(4-chlorophenyl)methyl]tetrahydro-, hydrochloride (1:1)

Description:

2H-Pyran-3-amine, 3-[(4-chlorophenyl)methyl]tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features an amine functional group, indicating the presence of a nitrogen atom that can participate in hydrogen bonding and influence its reactivity and solubility. The presence of a 4-chlorophenylmethyl group suggests that it has aromatic characteristics, which can enhance its biological activity and interaction with various receptors. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for pharmaceutical applications. The compound may exhibit various biological activities, potentially making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and biological activity, would need to be determined through experimental studies, as they can vary based on the compound's formulation and purity.

Formula: C₁₂H₁₆ClNO·ClH

InChI: InChI=1S/C12H16ClNO.ClH/c13-11-4-2-10(3-5-11)8-12(14)6-1-7-15-9-12;/h2-5H,1,6-9,14H2;1H

InChI key: InChIKey=UOPVTHCCWPJELU-UHFFFAOYSA-N

SMILES: C(C1(N)CCCOC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 2H-Pyran-3-amine, 3-[(4-chlorophenyl)methyl]tetrahydro-, hydrochloride (1:1)

3-[(4-Chlorophenyl)methyl]oxan-3-amine hydrochloride

CAS: 1803607-73-9

Versatile small molecule scaffold

Formula: C₁₂H₁₇Cl₂NO

Purity: Min. 95%

Molecular weight: 262.17 g/mol

Ref: 3D-DXC60773