CAS 1803607-78-4

4-Piperidinamine, 1-[1-(2-pyridinyl)ethyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[1-(2-pyridinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyridine moieties, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine ring suggests properties related to amine functionality, which may influence its interaction with biological targets, such as receptors or enzymes. The compound's structure indicates it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its specific stereochemistry and functional groups can affect its pharmacokinetics and pharmacodynamics, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 1803607-78-4, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound's unique structural features position it as a candidate for further investigation in drug discovery and development.

Formula: C₁₂H₁₉N₃·2ClH

InChI: InChI=1S/C12H19N3.2ClH/c1-10(12-4-2-3-7-14-12)15-8-5-11(13)6-9-15;;/h2-4,7,10-11H,5-6,8-9,13H2,1H3;2*1H

InChI key: InChIKey=HAURQPZSIURWQX-UHFFFAOYSA-N

SMILES: C(C)(N1CCC(N)CC1)C2=CC=CC=N2.Cl

Synonyms:

• 4-Piperidinamine, 1-[1-(2-pyridinyl)ethyl]-, hydrochloride (1:2)

1-[1-(Pyridin-2-yl)ethyl]piperidin-4-amine dihydrochloride

CAS: 1803607-78-4

Versatile small molecule scaffold

Formula: C₁₂H₂₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 278.22 g/mol

Ref: 3D-DXC60778