CAS 1803607-79-5

3-Pyrrolidinamine, N-ethyl-N-methyl-, hydrochloride (1:2)

Description:

3-Pyrrolidinamine, N-ethyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This substance features two alkyl substituents, specifically ethyl and methyl groups, attached to the nitrogen atom of the pyrrolidine ring, contributing to its amine properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and research. The presence of the hydrochloride indicates that the compound is protonated, which can influence its reactivity and interaction with biological systems. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₇H₁₆N₂·2ClH

InChI: InChI=1S/C7H16N2.2ClH/c1-3-9(2)7-4-5-8-6-7;;/h7-8H,3-6H2,1-2H3;2*1H

InChI key: InChIKey=UOEWZFGQNJXKRD-UHFFFAOYSA-N

SMILES: N(CC)(C)C1CCNC1.Cl

Synonyms:

• 3-Pyrrolidinamine, N-ethyl-N-methyl-, hydrochloride (1:2)

N-Ethyl-N-methylpyrrolidin-3-amine dihydrochloride

CAS: 1803607-79-5

Versatile small molecule scaffold

Formula: C₇H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 201.13 g/mol

Ref: 3D-DXC60779