CAS 1803607-83-1

2(1H)-Pyrimidinone, 1-(3-aminopropyl)-, hydrochloride (1:2)

Description:

2(1H)-Pyrimidinone, 1-(3-aminopropyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidinone core structure, which is a six-membered aromatic ring containing nitrogen atoms. This compound features an aminoalkyl side chain, specifically a propyl group with an amino functional group, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The presence of the amino group suggests possible interactions with biological receptors or enzymes, making it a candidate for further research in medicinal chemistry. Additionally, the compound's molecular structure may exhibit specific stereochemistry, which can affect its biological activity and interactions. Overall, this substance represents a class of compounds that could be significant in drug discovery and development.

Formula: C₇H₁₁N₃O·2ClH

InChI: InChI=1S/C7H11N3O.2ClH/c8-3-1-5-10-6-2-4-9-7(10)11;;/h2,4,6H,1,3,5,8H2;2*1H

InChI key: InChIKey=LJUKETJQSYPXFM-UHFFFAOYSA-N

SMILES: C(CCN)N1C(=O)N=CC=C1.Cl

Synonyms:

• 2(1H)-Pyrimidinone, 1-(3-aminopropyl)-, hydrochloride (1:2)

1-(3-Aminopropyl)-1,2-dihydropyrimidin-2-one dihydrochloride

CAS: 1803607-83-1

Versatile small molecule scaffold

Formula: C₇H₁₃Cl₂N₃O

Purity: Min. 95%

Molecular weight: 226.1 g/mol

Ref: 3D-DXC60783