CAS 1803607-88-6

Benzenemethanamine, 3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1), with CAS number 1803607-88-6, is a chemical compound characterized by its complex structure, which includes a benzenemethanamine moiety and a 1,2,4-oxadiazole ring substituted with a trifluoroethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the trifluoroethyl group suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit unique biological activities and improved metabolic stability. The oxadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. As a hydrochloride salt, it is likely to be more stable and easier to handle in laboratory settings. Overall, this compound's unique structural features may make it of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₀F₃N₃O·ClH

InChI: InChI=1S/C11H10F3N3O.ClH/c12-11(13,14)5-9-16-10(18-17-9)8-3-1-2-7(4-8)6-15;/h1-4H,5-6,15H2;1H

InChI key: InChIKey=XFDNCXOFTJDAOH-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C=1N=C(ON1)C2=CC(CN)=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-, hydrochloride (1:1)

{3-[3-(2,2,2-Trifluoroethyl)-1,2,4-oxadiazol-5-yl]phenyl}methanamine hydrochloride

CAS: 1803607-88-6

Versatile small molecule scaffold

Formula: C₁₁H₁₁ClF₃N₃O

Purity: Min. 95%

Molecular weight: 293.67 g/mol

Ref: 3D-DXC60788