CAS 1803607-91-1

Piperazine, 1-(2-bromoethyl)-4-cyclopropyl-, hydrobromide (1:1)

Description:

Piperazine, 1-(2-bromoethyl)-4-cyclopropyl-, hydrobromide (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine featuring two nitrogen atoms. The presence of a bromoethyl group at the 1-position and a cyclopropyl group at the 4-position contributes to its unique reactivity and potential biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or analgesic effects, which are common in piperazine derivatives. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as halogenated compounds can pose health risks. Overall, this compound represents a specific class of piperazine derivatives with potential applications in drug development and research.

Formula: C₉H₁₇BrN₂·BrH

InChI: InChI=1S/C9H17BrN2.BrH/c10-3-4-11-5-7-12(8-6-11)9-1-2-9;/h9H,1-8H2;1H

InChI key: InChIKey=ADERKBQMWANOMH-UHFFFAOYSA-N

SMILES: C(CBr)N1CCN(C2CC2)CC1.Br

Synonyms:

• Piperazine, 1-(2-bromoethyl)-4-cyclopropyl-, hydrobromide (1:1)

1-(2-Bromoethyl)-4-cyclopropylpiperazine hydrobromide

CAS: 1803607-91-1

Versatile small molecule scaffold

Formula: C₉H₁₈Br₂N₂

Purity: Min. 95%

Molecular weight: 314.06 g/mol

Ref: 3D-DXC60791