CymitQuimica logo

CAS 1803608-04-9

:

Cyclohexanamine, 3-phenyl-, hydrochloride (1:1)

Description:
Cyclohexanamine, 3-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a cyclohexane ring structure. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound features a phenyl group attached to the cyclohexanamine, which can influence its reactivity and interaction with biological systems. Cyclohexanamine derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system due to their ability to cross the blood-brain barrier. The hydrochloride form enhances its solubility, making it easier to formulate in various dosage forms. Additionally, the presence of the amine group may impart basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity. Overall, this compound represents a significant interest in medicinal chemistry and related fields.
Formula:C12H17N·ClH
InChI:InChI=1S/C12H17N.ClH/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;/h1-3,5-6,11-12H,4,7-9,13H2;1H
InChI key:InChIKey=LSTROUZBDJNGLG-UHFFFAOYSA-N
SMILES:NC1CC(CCC1)C2=CC=CC=C2.Cl
Synonyms:
  • Cyclohexanamine, 3-phenyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.