CAS 1803608-18-5

8-Quinolinol, 4-methyl-, hydrobromide (1:1)

Description:

8-Quinolinol, 4-methyl-, hydrobromide (1:1) is a chemical compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound is a derivative of 8-quinolinol, with a methyl group substituted at the 4-position of the quinoline ring. The hydrobromide form indicates that it is a salt formed with hydrobromic acid, which enhances its solubility in polar solvents. Typically, compounds like this exhibit biological activity, often functioning as chelating agents or antimicrobial agents due to the presence of the hydroxyl group in the quinoline structure. The hydrobromide salt form can influence the compound's stability, solubility, and bioavailability. Additionally, the presence of the methyl group may affect its electronic properties and reactivity. As with many quinoline derivatives, this compound may be of interest in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₀H₉NO·BrH

InChI: InChI=1S/C10H9NO.BrH/c1-7-5-6-11-10-8(7)3-2-4-9(10)12;/h2-6,12H,1H3;1H

InChI key: InChIKey=OIXMXDNUPQEYFN-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(O)=CC=C2)N=CC1.Br

Synonyms:

• 8-Quinolinol, 4-methyl-, hydrobromide (1:1)

4-Methylquinolin-8-ol hydrobromide

CAS: 1803608-18-5

Versatile small molecule scaffold

Formula: C₁₀H₁₀BrNO

Purity: Min. 95%

Molecular weight: 240.1 g/mol

Ref: 3D-DXC60818