CAS 1803608-26-5

1-[2,5-Dimethyl-1-(phenylmethyl)-1H-pyrrol-3-yl]-2,2,2-trifluoroethanone

Description:

1-[2,5-Dimethyl-1-(phenylmethyl)-1H-pyrrol-3-yl]-2,2,2-trifluoroethanone is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring substituted with both methyl and phenylmethyl groups, as well as a trifluoroethanone moiety. The presence of the trifluoroethanone group imparts unique electronic properties, making the compound potentially useful in various chemical applications, including medicinal chemistry and material science. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, which can influence the biological activity of the compound. Additionally, the pyrrole ring contributes to the compound's aromaticity and can participate in various chemical reactions, such as electrophilic substitutions. The compound's molecular structure suggests potential interactions with biological targets, making it of interest for drug development. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases, as they are not universally defined for all compounds.

Formula: C₁₅H₁₄F₃NO

InChI: InChI=1S/C15H14F3NO/c1-10-8-13(14(20)15(16,17)18)11(2)19(10)9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3

InChI key: InChIKey=QNSIRAJXGSFGNF-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C(C)N(CC2=CC=CC=C2)C(C)=C1

Synonyms:

• 1-[2,5-Dimethyl-1-(phenylmethyl)-1H-pyrrol-3-yl]-2,2,2-trifluoroethanone
• Ethanone, 1-[2,5-dimethyl-1-(phenylmethyl)-1H-pyrrol-3-yl]-2,2,2-trifluoro-
• 1-(1-Benzyl-2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoroethan-1-one

1-(1-Benzyl-2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoroethan-1-one

CAS: 1803608-26-5

Versatile small molecule scaffold

Formula: C₁₅H₁₄F₃NO

Purity: Min. 95%

Molecular weight: 281.27 g/mol

Ref: 3D-DXC60826