CAS 1803608-38-9

4-Pyridineacetic acid, 2-methoxy-, hydrochloride (1:1)

Description:

4-Pyridineacetic acid, 2-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and acetic acid functional groups, along with a methoxy substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the pyridine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The methoxy group can influence the compound's electronic properties and reactivity. As a hydrochloride salt, it is often more stable and easier to handle than its free base counterpart. This compound may exhibit various properties such as acidity, basicity, and potential interactions with biological targets, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₉NO₃·ClH

InChI: InChI=1S/C8H9NO3.ClH/c1-12-7-4-6(2-3-9-7)5-8(10)11;/h2-4H,5H2,1H3,(H,10,11);1H

InChI key: InChIKey=LXEQJLPUICEYDD-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(OC)N=CC1.Cl

Synonyms:

• 4-Pyridineacetic acid, 2-methoxy-, hydrochloride (1:1)

2-(2-Methoxypyridin-4-yl)acetic acid hydrochloride

CAS: 1803608-38-9

Versatile small molecule scaffold

Formula: C₈H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 203.62 g/mol

Ref: 3D-DXC60838