CAS 1803608-46-9

Carbamic acid, N-(4-cyclopropyl-5-oxazolyl)-, 1,1-dimethylethyl ester

Description:

Carbamic acid, N-(4-cyclopropyl-5-oxazolyl)-, 1,1-dimethylethyl ester, identified by CAS number 1803608-46-9, is a chemical compound characterized by its unique structural features, including a carbamic acid moiety and an oxazole ring. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the cyclopropyl group and the oxazole ring may impart specific biological activities or reactivity patterns, making it of interest in medicinal chemistry and drug development. Its ester functional group suggests potential for hydrolysis under acidic or basic conditions, leading to the release of the corresponding carbamic acid and alcohol. Additionally, the compound's stability, reactivity, and potential applications can be influenced by the steric and electronic effects of the substituents on the oxazole and cyclopropyl groups. Overall, this compound represents a class of organic molecules that may have implications in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₆N₂O₃

InChI: InChI=1S/C11H16N2O3/c1-11(2,3)16-10(14)13-9-8(7-4-5-7)12-6-15-9/h6-7H,4-5H2,1-3H3,(H,13,14)

InChI key: InChIKey=HHQJCMNOHICGGA-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(N=CO1)C2CC2

Synonyms:

• tert-Butyl N-(4-cyclopropyl-1,3-oxazol-5-yl)carbamate
• Carbamic acid, N-(4-cyclopropyl-5-oxazolyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(4-cyclopropyl-5-oxazolyl)carbamate

tert-Butyl N-(4-cyclopropyl-1,3-oxazol-5-yl)carbamate

CAS: 1803608-46-9

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 224.26 g/mol

Ref: 3D-DXC60846