CAS 1803608-54-9

Butanamide, N-(4-acetyl-2-thiazolyl)-3-amino-, hydrochloride (1:1)

Description:

Butanamide, N-(4-acetyl-2-thiazolyl)-3-amino-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a thiazole ring, specifically a 4-acetyl-2-thiazolyl moiety, contributes to its unique properties, including potential biological activity. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. This substance may exhibit characteristics such as moderate stability under standard conditions, and its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The molecular interactions could involve hydrogen bonding and π-π stacking due to the aromatic thiazole component. As with many amides, it may also display moderate polarity, affecting its behavior in various solvents. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to elucidate its specific applications and biological effects.

Formula: C₉H₁₃N₃O₂S·ClH

InChI: InChI=1S/C9H13N3O2S.ClH/c1-5(10)3-8(14)12-9-11-7(4-15-9)6(2)13;/h4-5H,3,10H2,1-2H3,(H,11,12,14);1H

InChI key: InChIKey=QXVODDKRAQTMLB-UHFFFAOYSA-N

SMILES: N(C(CC(C)N)=O)C1=NC(C(C)=O)=CS1.Cl

Synonyms:

• Butanamide, N-(4-acetyl-2-thiazolyl)-3-amino-, hydrochloride (1:1)

N-(4-Acetyl-1,3-thiazol-2-yl)-3-aminobutanamide hydrochloride

CAS: 1803608-54-9

Versatile small molecule scaffold

Formula: C₉H₁₄ClN₃O₂S

Purity: Min. 95%

Molecular weight: 263.75 g/mol

Ref: 3D-DXC60854